عرض مصدر تيانبتين

{{صندوق معلومات دواء
| Verifiedfields = changed
| verifiedrevid = 455249171
| IUPAC_name = 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoic acid
| image = Tianeptine2DACS.svg
| image2 =
<!--Clinical data-->
| tradename = Coaxil, Stablon
| Drugs.com = {{drugs.com|international|tianeptine}}
| legal_status = Rx-only (تيانبتين)
Legal (Unscheduled) ([[الولايات المتحدة|US]])
Controlled ([[فرنسا]]، [[البحرين|BH]]، [[سنغافورة|SG]])
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = 99%<ref name="pmid3180120">{{استشهاد بدورية محكمة| مؤلف = Royer, RJ; Albin, H; Barrucand, D; Salvadori-Failler, C; Kamoun, A|عنوان = Pharmacokinetic and metabolic parameters of tianeptine in healthy volunteers and in populations with risk factors | صحيفة = Clinical Neuropharmacology | المجلد = 11 Suppl 2 | العدد = | صفحات = S90–6 | سنة = 1988 | pmid = 3180120 | doi = | مسار = }}</ref><ref name = Tian2001>{{استشهاد بدورية محكمة|عنوان=Tianeptine A Review of its Use in Depressive Disorders|صحيفة=CNS Drugs|تاريخ=مارس 2001|المجلد=15|العدد=3|doi=10.2165/00023210-200115030-00006|صفحات=231–259|pmid=11463130|مؤلف=Wagstaff, AJ; Ormrod, D; Spencer, CM}}</ref>
| protein_bound = 95%<ref name = Tian2001/>
| metabolism = [[كبد]]<ref name = Tian2001/>
| elimination_half-life = 2.5-3 hours,<ref name="pmid3180120" /><ref name = Tian2001/> 4-9 hours (elderly)<ref name =Tian2001/><ref>{{استشهاد بدورية محكمة|عنوان=Pharmacokinetics and bioavailability of tianeptine in the elderly|صحيفة=Drug Investigation|تاريخ=September 1990|المجلد=2|العدد=3|صفحات=167–172|doi=10.1007/BF03259191|مؤلف=Carlhant, D; Le Garrec, J; Guedes, Y; Salvadori, C; Mottier, D; Riche, C}}</ref>
| excretion = [[كلية (عضو)|كلية]] (65%),<ref name="pmid3180120" /> [[براز]] (15%)<ref name =Tian2001/>
<!--Identifiers-->
| IUPHAR_ligand = 7558
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 66981-73-5
| ATC_prefix = N06
| ATC_suffix = AX14
| PubChem = 68870
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 62102
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1289110
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0T493YFU8O
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02575
<!--Chemical data-->
| C=21 | H=25 | Cl=1 | N=2 | O=4 | S=1
| molecular_weight = 436.953 g/mol
| smiles = Clc1cc2c(cc1)C(c3c(N(C)S2(=O)=O)cccc3)NCCCCCCC(=O)O
| InChI = 1/C21H25ClN2O4S/c1-24-18-9-6-5-8-16(18)21(23-13-7-3-2-4-10-20(25)26)17-12-11-15(22)14-19(17)29(24,27)28/h5-6,8-9,11-12,14,21,23H,2-4,7,10,13H2,1H3,(H,25,26)
| InChIKey = JICJBGPOMZQUBB-UHFFFAOYAW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H25ClN2O4S/c1-24-18-9-6-5-8-16(18)21(23-13-7-3-2-4-10-20(25)26)17-12-11-15(22)14-19(17)29(24,27)28/h5-6,8-9,11-12,14,21,23H,2-4,7,10,13H2,1H3,(H,25,26)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JICJBGPOMZQUBB-UHFFFAOYSA-N
}}
'''تيانبتين''' هو دواء يستخدم بشكل أساسي لعلاج [[الاضطراب الاكتئابي]]، كما يستخدم لعلاج ال[[ربو]] و[[متلازمة القولون المتهيج]].
التركيب الكيميائي مرتبط ب[[مضادات الاكتئاب ثلاثية الحلقات]] لكنه يختلف في مفعوله الدوائي المضاد للاكتئا، ويعتقد أن السبب هو تأثير غير مباشر على مستقبلات ال[[غلوتامات]] (أي [[مستقبل AMPA]] و[[مستقبل ن-مثيل-د-أسبارتات]]) وإطلاق [[عامل التغذية العصبية المستمد من الدماغ]] مما يؤثر على [[اللدونة العصبية]].<ref name = mp09>{{استشهاد بدورية محكمة|الأخير1=McEwen|الأول1=BS|الأخير2=Chattarji|الأول2=S|الأخير3=Diamond|الأول3=DM|الأخير4=Jay|الأول4=TM|الأخير5=Reagan|الأول5=LP|الأخير6=Svenningsson|الأول6=P|الأخير7=Fuchs|الأول7=E|عنوان=The neurobiological properties of tianeptine (Stablon): from monoamine hypothesis to glutamatergic modulation.|صحيفة=Molecular Psychiatry|تاريخ=مارس 2010|المجلد=15|العدد=3|صفحات=237–49|doi=10.1038/mp.2009.80|pmid=19704408|مسار= https://www.ncbi.nlm.nih.gov/pmc/articles/PMC2902200/|pmc=2902200|مسار أرشيف= https://web.archive.org/web/20190411202758/https://www.ncbi.nlm.nih.gov/pmc/articles/PMC2902200/|تاريخ أرشيف=2019-04-11}}</ref><ref name="pmid15550348">{{استشهاد بدورية محكمة|مؤلف=McEwen, BS; Chattarji, S |عنوان=Molecular mechanisms of neuroplasticity and pharmacological implications: the example of tianeptine |صحيفة=European Neuropsychopharmacology |المجلد=14 Suppl 5 |العدد= |صفحات=S497–502 |تاريخ=ديسمبر 2004 |pmid=15550348 |doi=10.1016/j.euroneuro.2004.09.008 |مسار= }}</ref><ref name="pmid15753957">{{استشهاد بدورية محكمة|مؤلف=McEwen, BS; Olié, JP |عنوان=Neurobiology of mood, anxiety, and emotions as revealed by studies of a unique antidepressant: tianeptine |صحيفة=Molecular Psychiatry |المجلد=10 |العدد=6 |صفحات=525–37 |تاريخ=يونيو 2005 |pmid=15753957 |doi=10.1038/sj.mp.4001648 |مسار= }}</ref><ref name="pmid18221189">{{استشهاد بدورية محكمة|مؤلف=Brink, CB; Harvey, BH; Brand, L |عنوان=Tianeptine: a novel atypical antidepressant that may provide new insights into the biomolecular basis of depression |صحيفة=Recent Patents on CNS Drug Discovery |المجلد=1 |العدد=1 |صفحات=29–41 |تاريخ=يناير 2006 |pmid=18221189 |doi= 10.2174/157488906775245327|مسار= https://www.bentham-direct.org/app000092/|مسار أرشيف= https://web.archive.org/web/20191215175947/http://www.bentham-direct.org/pages/content.php?PRN/2006/00000001/00000001/0002PRN.SGM|تاريخ أرشيف=2019-12-15}}</ref><ref name=CNS2008>{{استشهاد بدورية محكمة|مؤلف=Kasper, S; McEwen, BS |عنوان=Neurobiological and clinical effects of the antidepressant tianeptine |صحيفة=CNS Drugs |المجلد=22 |العدد=1 |صفحات=15–26 |سنة=2008 |pmid=18072812 |doi= 10.2165/00023210-200822010-00002|مسار= }}</ref>